C16H26O2 — CID 103028364
4-methoxy-4-methyl-1-(2,4,6-trimethylphenyl)pentan-1-ol (PubChem CID 103028364) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-methoxy-4-methyl-1-(2,4,6-trimethylphenyl)pentan-1-ol.
| Compound Name | 4-methoxy-4-methyl-1-(2,4,6-trimethylphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 103028364 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-methoxy-4-methyl-1-(2,4,6-trimethylphenyl)pentan-1-ol |
| SMILES | COC(C)(C)CCC(O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H26O2/c1-11-9-12(2)15(13(3)10-11)14(17)7-8-16(4,5)18-6/h9-10,14,17H,7-8H2,1-6H3 |
| InChIKey | WEACZKJIAKRFCF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |