C11H22F3NO — CID 103028745
8,8,8-trifluoro-2-methoxy-N,2-dimethyloctan-4-amine (PubChem CID 103028745) has the molecular formula C11H22F3NO and a molecular weight of 241.30 g/mol. Its IUPAC name is 8,8,8-trifluoro-2-methoxy-N,2-dimethyloctan-4-amine.
| Compound Name | 8,8,8-trifluoro-2-methoxy-N,2-dimethyloctan-4-amine |
|---|---|
| PubChem CID | 103028745 |
| Molecular Formula | C11H22F3NO |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 8,8,8-trifluoro-2-methoxy-N,2-dimethyloctan-4-amine |
| SMILES | CNC(CCCC(F)(F)F)CC(C)(C)OC |
| InChI | InChI=1S/C11H22F3NO/c1-10(2,16-4)8-9(15-3)6-5-7-11(12,13)14/h9,15H,5-8H2,1-4H3 |
| InChIKey | YLJIQGJQLUKAAF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |