C11H17N3O2 — CID 103028992
N,N-bis(2-cyanoethyl)-2-methoxy-2-methylpropanamide (PubChem CID 103028992) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-methoxy-2-methylpropanamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 103028992 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)N(CCC#N)CCC#N |
| InChI | InChI=1S/C11H17N3O2/c1-11(2,16-3)10(15)14(8-4-6-12)9-5-7-13/h4-5,8-9H2,1-3H3 |
| InChIKey | HOWHMSIXMCGJGM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |