C15H19N5 — CID 103029759
1-(benzimidazol-1-yl)-4-(1-methylpyrazol-4-yl)butan-2-amine (PubChem CID 103029759) has the molecular formula C15H19N5 and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-(benzimidazol-1-yl)-4-(1-methylpyrazol-4-yl)butan-2-amine.
| Compound Name | 1-(benzimidazol-1-yl)-4-(1-methylpyrazol-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 103029759 |
| Molecular Formula | C15H19N5 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-(benzimidazol-1-yl)-4-(1-methylpyrazol-4-yl)butan-2-amine |
| SMILES | Cn1cc(CCC(N)Cn2cnc3ccccc32)cn1 |
| InChI | InChI=1S/C15H19N5/c1-19-9-12(8-18-19)6-7-13(16)10-20-11-17-14-4-2-3-5-15(14)20/h2-5,8-9,11,13H,6-7,10,16H2,1H3 |
| InChIKey | PFDDRVBCTGDCDS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |