C14H22F3N3 — CID 103030057
3-(1-methylpyrazol-4-yl)-1-[3-(trifluoromethyl)cyclohexyl]propan-1-amine (PubChem CID 103030057) has the molecular formula C14H22F3N3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-(1-methylpyrazol-4-yl)-1-[3-(trifluoromethyl)cyclohexyl]propan-1-amine.
| Compound Name | 3-(1-methylpyrazol-4-yl)-1-[3-(trifluoromethyl)cyclohexyl]propan-1-amine |
|---|---|
| PubChem CID | 103030057 |
| Molecular Formula | C14H22F3N3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-(1-methylpyrazol-4-yl)-1-[3-(trifluoromethyl)cyclohexyl]propan-1-amine |
| SMILES | Cn1cc(CCC(N)C2CCCC(C(F)(F)F)C2)cn1 |
| InChI | InChI=1S/C14H22F3N3/c1-20-9-10(8-19-20)5-6-13(18)11-3-2-4-12(7-11)14(15,16)17/h8-9,11-13H,2-7,18H2,1H3 |
| InChIKey | ONOVKMKEMSDLEP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |