C10H15N5S — CID 103030587
N-methyl-3-(2-methylpyrazol-3-yl)-1-(thiadiazol-5-yl)propan-1-amine (PubChem CID 103030587) has the molecular formula C10H15N5S and a molecular weight of 237.33 g/mol. Its IUPAC name is N-methyl-3-(2-methylpyrazol-3-yl)-1-(thiadiazol-5-yl)propan-1-amine.
| Compound Name | N-methyl-3-(2-methylpyrazol-3-yl)-1-(thiadiazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 103030587 |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-methyl-3-(2-methylpyrazol-3-yl)-1-(thiadiazol-5-yl)propan-1-amine |
| SMILES | CNC(CCc1ccnn1C)c1cnns1 |
| InChI | InChI=1S/C10H15N5S/c1-11-9(10-7-12-14-16-10)4-3-8-5-6-13-15(8)2/h5-7,9,11H,3-4H2,1-2H3 |
| InChIKey | KBXCNWGQFYPNSW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |