C27H18Cl4N2O3 — CID 10303103
1-N,3-N-bis(3,4-dichlorophenyl)-5-phenylmethoxybenzene-1,3-dicarboxamide (PubChem CID 10303103) has the molecular formula C27H18Cl4N2O3 and a molecular weight of 560.26 g/mol. Its IUPAC name is 1-N,3-N-bis(3,4-dichlorophenyl)-5-phenylmethoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(3,4-dichlorophenyl)-5-phenylmethoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 10303103 |
| Molecular Formula | C27H18Cl4N2O3 |
| Molecular Weight | 560.26 g/mol |
| Exact Mass | 558.01 |
| IUPAC Name | 1-N,3-N-bis(3,4-dichlorophenyl)-5-phenylmethoxybenzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)c1cc(OCc2ccccc2)cc(C(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C27H18Cl4N2O3/c28-22-8-6-19(13-24(22)30)32-26(34)17-10-18(27(35)33-20-7-9-23(29)25(31)14-20)12-21(11-17)36-15-16-4-2-1-3-5-16/h1-14H,15H2,(H,32,34)(H,33,35) |
| InChIKey | UEIKZMSETCIBFL-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.26 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |