About 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine
1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine (PubChem CID 103031595) has the molecular formula C14H27N3OS
and a molecular weight of 285.46 g/mol. Its IUPAC name is 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine |
| PubChem CID | 103031595 |
| Molecular Formula | C14H27N3OS |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine |
| SMILES | CNC(CCC(C)(C)OC)c1snnc1C(C)(C)C |
| InChI | InChI=1S/C14H27N3OS/c1-13(2,3)12-11(19-17-16-12)10(15-6)8-9-14(4,5)18-7/h10,15H,8-9H2,1-7H3 |
| InChIKey | DBQKYRKMGPWCDZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine?
The IUPAC name of 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine (CID 103031595) is 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine.
What is the SMILES notation for 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine?
The canonical SMILES for 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine is CNC(CCC(C)(C)OC)c1snnc1C(C)(C)C.
What is the InChIKey of 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine?
The InChIKey is DBQKYRKMGPWCDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3OS/c1-13(2,3)12-11(19-17-16-12)10(15-6)8-9-14(4,5)18-7/h10,15H,8-9H2,1-7H3.
What are the key properties of 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine?
1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine has a molecular weight of 285.46 g/mol, XLogP of 3.30, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butylthiadiazol-5-yl)-4-methoxy-N,4-dimethylpentan-1-amine is sourced from PubChem (CID 103031595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).