About 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline
2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline (PubChem CID 10303161) has the molecular formula C26H16Cl4N2S2
and a molecular weight of 562.37 g/mol. Its IUPAC name is 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline.
Molecular Properties
| Compound Name | 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline |
| PubChem CID | 10303161 |
| Molecular Formula | C26H16Cl4N2S2 |
| Molecular Weight | 562.37 g/mol |
| Exact Mass | 559.95 |
| IUPAC Name | 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline |
| SMILES | Clc1ccc(Cl)c(SCc2nc3cc4ccccc4cc3nc2CSc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C26H16Cl4N2S2/c27-17-5-7-19(29)25(11-17)33-13-23-24(14-34-26-12-18(28)6-8-20(26)30)32-22-10-16-4-2-1-3-15(16)9-21(22)31-23/h1-12H,13-14H2 |
| InChIKey | QNPLAGAHHACHIX-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.37 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline?
The IUPAC name of 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline (CID 10303161) is 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline.
What is the SMILES notation for 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline?
The canonical SMILES for 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline is Clc1ccc(Cl)c(SCc2nc3cc4ccccc4cc3nc2CSc2cc(Cl)ccc2Cl)c1.
What is the InChIKey of 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline?
The InChIKey is QNPLAGAHHACHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16Cl4N2S2/c27-17-5-7-19(29)25(11-17)33-13-23-24(14-34-26-12-18(28)6-8-20(26)30)32-22-10-16-4-2-1-3-15(16)9-21(22)31-23/h1-12H,13-14H2.
What are the key properties of 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline?
2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline has a molecular weight of 562.37 g/mol, XLogP of 9.98, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis[(2,5-dichlorophenyl)sulfanylmethyl]benzo[g]quinoxaline is sourced from PubChem (CID 10303161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).