C16H23N3O — CID 103032278
4-methoxy-N,4-dimethyl-1-quinoxalin-5-ylpentan-1-amine (PubChem CID 103032278) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-methoxy-N,4-dimethyl-1-quinoxalin-5-ylpentan-1-amine.
| Compound Name | 4-methoxy-N,4-dimethyl-1-quinoxalin-5-ylpentan-1-amine |
|---|---|
| PubChem CID | 103032278 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 4-methoxy-N,4-dimethyl-1-quinoxalin-5-ylpentan-1-amine |
| SMILES | CNC(CCC(C)(C)OC)c1cccc2nccnc12 |
| InChI | InChI=1S/C16H23N3O/c1-16(2,20-4)9-8-13(17-3)12-6-5-7-14-15(12)19-11-10-18-14/h5-7,10-11,13,17H,8-9H2,1-4H3 |
| InChIKey | HPPPAWDXGPMYRE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |