C13H24O4 — CID 103032588
4-(3-methoxy-3-methylbutoxy)cyclohexane-1-carboxylic acid (PubChem CID 103032588) has the molecular formula C13H24O4 and a molecular weight of 244.33 g/mol. Its IUPAC name is 4-(3-methoxy-3-methylbutoxy)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(3-methoxy-3-methylbutoxy)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 103032588 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | 4-(3-methoxy-3-methylbutoxy)cyclohexane-1-carboxylic acid |
| SMILES | COC(C)(C)CCOC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H24O4/c1-13(2,16-3)8-9-17-11-6-4-10(5-7-11)12(14)15/h10-11H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | NGEIPXKRMVLBED-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |