C27H32F6N6O — CID 10303422
1-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine (PubChem CID 10303422) has the molecular formula C27H32F6N6O and a molecular weight of 570.58 g/mol. Its IUPAC name is 1-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine.
| Compound Name | 1-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine |
|---|---|
| PubChem CID | 10303422 |
| Molecular Formula | C27H32F6N6O |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | 1-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-phenylethyl]-4-[4-(2H-tetrazol-5-yl)butyl]piperazine |
| SMILES | CC(OCC(c1ccccc1)N1CCN(CCCCc2nn[nH]n2)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H32F6N6O/c1-19(21-15-22(26(28,29)30)17-23(16-21)27(31,32)33)40-18-24(20-7-3-2-4-8-20)39-13-11-38(12-14-39)10-6-5-9-25-34-36-37-35-25/h2-4,7-8,15-17,19,24H,5-6,9-14,18H2,1H3,(H,34,35,36,37) |
| InChIKey | DBGFKWWOFVAQSG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|