C30H46F3NO6 — CID 10303529
[8-[7-(butylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 10303529) has the molecular formula C30H46F3NO6 and a molecular weight of 573.69 g/mol. Its IUPAC name is [8-[7-(butylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [8-[7-(butylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 10303529 |
| Molecular Formula | C30H46F3NO6 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.33 |
| IUPAC Name | [8-[7-(butylamino)-3-hydroxy-7-oxo-5-(2,2,2-trifluoroacetyl)oxyheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCCCNC(=O)CC(CC(O)CCC1C(C)C=CC2=CC(C)CC(OC(=O)C(C)CC)C21)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C30H46F3NO6/c1-6-8-13-34-26(36)17-23(39-29(38)30(31,32)33)16-22(35)11-12-24-20(5)9-10-21-14-18(3)15-25(27(21)24)40-28(37)19(4)7-2/h9-10,14,18-20,22-25,27,35H,6-8,11-13,15-17H2,1-5H3,(H,34,36) |
| InChIKey | DNNOTLPNRDDDQT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|