C14H32N2O — CID 103035810
2-N,2-N-diethyl-6-methoxy-2,6-dimethylheptane-2,3-diamine (PubChem CID 103035810) has the molecular formula C14H32N2O and a molecular weight of 244.42 g/mol. Its IUPAC name is 2-N,2-N-diethyl-6-methoxy-2,6-dimethylheptane-2,3-diamine.
| Compound Name | 2-N,2-N-diethyl-6-methoxy-2,6-dimethylheptane-2,3-diamine |
|---|---|
| PubChem CID | 103035810 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | 2-N,2-N-diethyl-6-methoxy-2,6-dimethylheptane-2,3-diamine |
| SMILES | CCN(CC)C(C)(C)C(N)CCC(C)(C)OC |
| InChI | InChI=1S/C14H32N2O/c1-8-16(9-2)14(5,6)12(15)10-11-13(3,4)17-7/h12H,8-11,15H2,1-7H3 |
| InChIKey | NWDRXCXNYYQLOX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |