C18H30FNO — CID 103036910
N-tert-butyl-2-(3-fluorophenyl)-5-methoxy-5-methylhexan-1-amine (PubChem CID 103036910) has the molecular formula C18H30FNO and a molecular weight of 295.44 g/mol. Its IUPAC name is N-tert-butyl-2-(3-fluorophenyl)-5-methoxy-5-methylhexan-1-amine.
| Compound Name | N-tert-butyl-2-(3-fluorophenyl)-5-methoxy-5-methylhexan-1-amine |
|---|---|
| PubChem CID | 103036910 |
| Molecular Formula | C18H30FNO |
| Molecular Weight | 295.44 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | N-tert-butyl-2-(3-fluorophenyl)-5-methoxy-5-methylhexan-1-amine |
| SMILES | COC(C)(C)CCC(CNC(C)(C)C)c1cccc(F)c1 |
| InChI | InChI=1S/C18H30FNO/c1-17(2,3)20-13-15(10-11-18(4,5)21-6)14-8-7-9-16(19)12-14/h7-9,12,15,20H,10-11,13H2,1-6H3 |
| InChIKey | NDHSCGBAKVJCPF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |