C16H13ClFNO2 — CID 103038200
(NZ)-N-[4-[(3-chloro-4-fluorophenyl)methoxy]-2,3-dihydroinden-1-ylidene]hydroxylamine (PubChem CID 103038200) has the molecular formula C16H13ClFNO2 and a molecular weight of 305.74 g/mol. Its IUPAC name is (NZ)-N-[4-[(3-chloro-4-fluorophenyl)methoxy]-2,3-dihydroinden-1-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[4-[(3-chloro-4-fluorophenyl)methoxy]-2,3-dihydroinden-1-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 103038200 |
| Molecular Formula | C16H13ClFNO2 |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (NZ)-N-[4-[(3-chloro-4-fluorophenyl)methoxy]-2,3-dihydroinden-1-ylidene]hydroxylamine |
| SMILES | O/N=C1/CCc2c(OCc3ccc(F)c(Cl)c3)cccc21 |
| InChI | InChI=1S/C16H13ClFNO2/c17-13-8-10(4-6-14(13)18)9-21-16-3-1-2-11-12(16)5-7-15(11)19-20/h1-4,6,8,20H,5,7,9H2/b19-15- |
| InChIKey | FCOGWLOSQQTAQJ-CYVLTUHYSA-N |
| XLogP | 4.18 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|