C15H14Cl2FN — CID 103039760
2-(3-chloro-4-fluorophenyl)-1-(4-chlorophenyl)-N-methylethanamine (PubChem CID 103039760) has the molecular formula C15H14Cl2FN and a molecular weight of 298.19 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1-(4-chlorophenyl)-N-methylethanamine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1-(4-chlorophenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 103039760 |
| Molecular Formula | C15H14Cl2FN |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1-(4-chlorophenyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccc(F)c(Cl)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14Cl2FN/c1-19-15(11-3-5-12(16)6-4-11)9-10-2-7-14(18)13(17)8-10/h2-8,15,19H,9H2,1H3 |
| InChIKey | DIAQRYXSZATAJP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |