C17H28ClFN2 — CID 103040222
1-(3-chloro-4-fluorophenyl)-3-N,3-N,3-triethylpentane-2,3-diamine (PubChem CID 103040222) has the molecular formula C17H28ClFN2 and a molecular weight of 314.88 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-N,3-N,3-triethylpentane-2,3-diamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-N,3-N,3-triethylpentane-2,3-diamine |
|---|---|
| PubChem CID | 103040222 |
| Molecular Formula | C17H28ClFN2 |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-N,3-N,3-triethylpentane-2,3-diamine |
| SMILES | CCN(CC)C(CC)(CC)C(N)Cc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H28ClFN2/c1-5-17(6-2,21(7-3)8-4)16(20)12-13-9-10-15(19)14(18)11-13/h9-11,16H,5-8,12,20H2,1-4H3 |
| InChIKey | XVOUXYMFEQUTTO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |