C29H33Cl2F3N4O2 — CID 10304077
1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-[4-[3-(trifluoromethoxy)phenyl]phenyl]butyl]urea (PubChem CID 10304077) has the molecular formula C29H33Cl2F3N4O2 and a molecular weight of 597.51 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-[4-[3-(trifluoromethoxy)phenyl]phenyl]butyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-[4-[3-(trifluoromethoxy)phenyl]phenyl]butyl]urea |
|---|---|
| PubChem CID | 10304077 |
| Molecular Formula | C29H33Cl2F3N4O2 |
| Molecular Weight | 597.51 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-[4-[3-(trifluoromethoxy)phenyl]phenyl]butyl]urea |
| SMILES | CN(C)CCCNCCC(CNC(=O)Nc1cc(Cl)cc(Cl)c1)c1ccc(-c2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H33Cl2F3N4O2/c1-38(2)14-4-12-35-13-11-23(19-36-28(39)37-26-17-24(30)16-25(31)18-26)21-9-7-20(8-10-21)22-5-3-6-27(15-22)40-29(32,33)34/h3,5-10,15-18,23,35H,4,11-14,19H2,1-2H3,(H2,36,37,39) |
| InChIKey | GTVWLYBGITXDFU-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.51 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|