C11H8ClFN2O2 — CID 103041458
1-[(3-chloro-4-fluorophenyl)methyl]pyrimidine-2,4-dione (PubChem CID 103041458) has the molecular formula C11H8ClFN2O2 and a molecular weight of 254.65 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 103041458 |
| Molecular Formula | C11H8ClFN2O2 |
| Molecular Weight | 254.65 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(Cc2ccc(F)c(Cl)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H8ClFN2O2/c12-8-5-7(1-2-9(8)13)6-15-4-3-10(16)14-11(15)17/h1-5H,6H2,(H,14,16,17) |
| InChIKey | XBHAQCCJTALJIR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.65 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |