C29H28Br2N4O — CID 10304301
N-[[1-[(3,5-dibromophenyl)methyl]indol-3-yl]methyl]-N'-(4-methoxyquinolin-2-yl)propane-1,3-diamine (PubChem CID 10304301) has the molecular formula C29H28Br2N4O and a molecular weight of 608.38 g/mol. Its IUPAC name is N-[[1-[(3,5-dibromophenyl)methyl]indol-3-yl]methyl]-N'-(4-methoxyquinolin-2-yl)propane-1,3-diamine.
| Compound Name | N-[[1-[(3,5-dibromophenyl)methyl]indol-3-yl]methyl]-N'-(4-methoxyquinolin-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 10304301 |
| Molecular Formula | C29H28Br2N4O |
| Molecular Weight | 608.38 g/mol |
| Exact Mass | 606.06 |
| IUPAC Name | N-[[1-[(3,5-dibromophenyl)methyl]indol-3-yl]methyl]-N'-(4-methoxyquinolin-2-yl)propane-1,3-diamine |
| SMILES | COc1cc(NCCCNCc2cn(Cc3cc(Br)cc(Br)c3)c3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C29H28Br2N4O/c1-36-28-16-29(34-26-9-4-2-8-25(26)28)33-12-6-11-32-17-21-19-35(27-10-5-3-7-24(21)27)18-20-13-22(30)15-23(31)14-20/h2-5,7-10,13-16,19,32H,6,11-12,17-18H2,1H3,(H,33,34) |
| InChIKey | LEQSNAOIRPQHDE-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.38 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|