C16H19N3O2 — CID 103044837
1-(1,4-diazepan-1-yl)-2-quinolin-5-yloxyethanone (PubChem CID 103044837) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)-2-quinolin-5-yloxyethanone.
| Compound Name | 1-(1,4-diazepan-1-yl)-2-quinolin-5-yloxyethanone |
|---|---|
| PubChem CID | 103044837 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)-2-quinolin-5-yloxyethanone |
| SMILES | O=C(COc1cccc2ncccc12)N1CCCNCC1 |
| InChI | InChI=1S/C16H19N3O2/c20-16(19-10-3-7-17-9-11-19)12-21-15-6-1-5-14-13(15)4-2-8-18-14/h1-2,4-6,8,17H,3,7,9-12H2 |
| InChIKey | QDPDPWTTWSYZJW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |