C38H50N6O2 — CID 10304569
3-(5-cyclohexyl-2-oxo-1-prop-2-enyl-3H-1,4-benzodiazepin-3-yl)-1-[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]-1-prop-2-enylurea (PubChem CID 10304569) has the molecular formula C38H50N6O2 and a molecular weight of 622.86 g/mol. Its IUPAC name is 3-(5-cyclohexyl-2-oxo-1-prop-2-enyl-3H-1,4-benzodiazepin-3-yl)-1-[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]-1-prop-2-enylurea.
| Compound Name | 3-(5-cyclohexyl-2-oxo-1-prop-2-enyl-3H-1,4-benzodiazepin-3-yl)-1-[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 10304569 |
| Molecular Formula | C38H50N6O2 |
| Molecular Weight | 622.86 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | 3-(5-cyclohexyl-2-oxo-1-prop-2-enyl-3H-1,4-benzodiazepin-3-yl)-1-[4-(4-piperidin-1-ylpiperidin-1-yl)phenyl]-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NC1N=C(C2CCCCC2)c2ccccc2N(CC=C)C1=O)c1ccc(N2CCC(N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C38H50N6O2/c1-3-23-43(32-19-17-30(18-20-32)42-27-21-31(22-28-42)41-25-11-6-12-26-41)38(46)40-36-37(45)44(24-4-2)34-16-10-9-15-33(34)35(39-36)29-13-7-5-8-14-29/h3-4,9-10,15-20,29,31,36H,1-2,5-8,11-14,21-28H2,(H,40,46) |
| InChIKey | QDYKAWPLOYDUBR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.86 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|