C33H42N8O5 — CID 10304705
1-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]-3-(2-piperidin-1-ylethyl)urea (PubChem CID 10304705) has the molecular formula C33H42N8O5 and a molecular weight of 630.75 g/mol. Its IUPAC name is 1-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]-3-(2-piperidin-1-ylethyl)urea.
| Compound Name | 1-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]-3-(2-piperidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 10304705 |
| Molecular Formula | C33H42N8O5 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.33 |
| IUPAC Name | 1-[[9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2,2-diphenylethylamino)purin-2-yl]methyl]-3-(2-piperidin-1-ylethyl)urea |
| SMILES | O=C(NCCN1CCCCC1)NCc1nc(NCC(c2ccccc2)c2ccccc2)c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C33H42N8O5/c42-20-25-28(43)29(44)32(46-25)41-21-37-27-30(35-18-24(22-10-4-1-5-11-22)23-12-6-2-7-13-23)38-26(39-31(27)41)19-36-33(45)34-14-17-40-15-8-3-9-16-40/h1-2,4-7,10-13,21,24-25,28-29,32,42-44H,3,8-9,14-20H2,(H2,34,36,45)(H,35,38,39)/t25-,28-,29-,32-/m1/s1 |
| InChIKey | VRJGUEOOJKHVOO-FANUBLADSA-N |
| XLogP | 1.97 |
| TPSA | 169.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |