C29H36N4O10S — CID 10304739
2-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]ethanesulfonic acid (PubChem CID 10304739) has the molecular formula C29H36N4O10S and a molecular weight of 632.69 g/mol. Its IUPAC name is 2-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]ethanesulfonic acid.
| Compound Name | 2-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 10304739 |
| Molecular Formula | C29H36N4O10S |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 2-[4-[2-[[2-[3-(1,3-dioxoisoindol-2-yl)-1-(hydroxyamino)-1-oxopropan-2-yl]-4-methylpentanoyl]amino]-3-(methylamino)-3-oxopropyl]phenoxy]ethanesulfonic acid |
| SMILES | CNC(=O)C(Cc1ccc(OCCS(=O)(=O)O)cc1)NC(=O)C(CC(C)C)C(CN1C(=O)c2ccccc2C1=O)C(=O)NO |
| InChI | InChI=1S/C29H36N4O10S/c1-17(2)14-22(23(26(35)32-39)16-33-28(37)20-6-4-5-7-21(20)29(33)38)25(34)31-24(27(36)30-3)15-18-8-10-19(11-9-18)43-12-13-44(40,41)42/h4-11,17,22-24,39H,12-16H2,1-3H3,(H,30,36)(H,31,34)(H,32,35)(H,40,41,42) |
| InChIKey | CQKZKPWIKOLKNN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 208.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|