C29H29ClFNO8S2 — CID 10304827
2-(1,2,3,4-tetrahydronaphthalene-2-carbonyloxy)ethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate (PubChem CID 10304827) has the molecular formula C29H29ClFNO8S2 and a molecular weight of 638.14 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydronaphthalene-2-carbonyloxy)ethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate.
| Compound Name | 2-(1,2,3,4-tetrahydronaphthalene-2-carbonyloxy)ethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 10304827 |
| Molecular Formula | C29H29ClFNO8S2 |
| Molecular Weight | 638.14 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | 2-(1,2,3,4-tetrahydronaphthalene-2-carbonyloxy)ethyl 9-(2-chloro-6-fluorophenyl)-7-methyl-1,1,4,4-tetraoxo-3,5,6,9-tetrahydro-2H-[1,4]dithiepino[6,5-b]pyridine-8-carboxylate |
| SMILES | CC1=C(C(=O)OCCOC(=O)C2CCc3ccccc3C2)C(c2c(F)cccc2Cl)C2=C(CS(=O)(=O)CCS2(=O)=O)N1 |
| InChI | InChI=1S/C29H29ClFNO8S2/c1-17-24(29(34)40-12-11-39-28(33)20-10-9-18-5-2-3-6-19(18)15-20)26(25-21(30)7-4-8-22(25)31)27-23(32-17)16-41(35,36)13-14-42(27,37)38/h2-8,20,26,32H,9-16H2,1H3 |
| InChIKey | YAZHLIZETONMCI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 132.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.14 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|