C16H16ClF2N — CID 103049776
3-(5-chloro-2-fluorophenyl)-2-(4-fluorophenyl)-N-methylpropan-1-amine (PubChem CID 103049776) has the molecular formula C16H16ClF2N and a molecular weight of 295.76 g/mol. Its IUPAC name is 3-(5-chloro-2-fluorophenyl)-2-(4-fluorophenyl)-N-methylpropan-1-amine.
| Compound Name | 3-(5-chloro-2-fluorophenyl)-2-(4-fluorophenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 103049776 |
| Molecular Formula | C16H16ClF2N |
| Molecular Weight | 295.76 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 3-(5-chloro-2-fluorophenyl)-2-(4-fluorophenyl)-N-methylpropan-1-amine |
| SMILES | CNCC(Cc1cc(Cl)ccc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H16ClF2N/c1-20-10-13(11-2-5-15(18)6-3-11)8-12-9-14(17)4-7-16(12)19/h2-7,9,13,20H,8,10H2,1H3 |
| InChIKey | CERDJBZPIGCNNB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.76 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |