C15H17ClFN — CID 103051008
1-[(5-chloro-2-fluorophenyl)methyl]-4-methylcyclohexane-1-carbonitrile (PubChem CID 103051008) has the molecular formula C15H17ClFN and a molecular weight of 265.76 g/mol. Its IUPAC name is 1-[(5-chloro-2-fluorophenyl)methyl]-4-methylcyclohexane-1-carbonitrile.
| Compound Name | 1-[(5-chloro-2-fluorophenyl)methyl]-4-methylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 103051008 |
| Molecular Formula | C15H17ClFN |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-[(5-chloro-2-fluorophenyl)methyl]-4-methylcyclohexane-1-carbonitrile |
| SMILES | CC1CCC(C#N)(Cc2cc(Cl)ccc2F)CC1 |
| InChI | InChI=1S/C15H17ClFN/c1-11-4-6-15(10-18,7-5-11)9-12-8-13(16)2-3-14(12)17/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | NEJTWVBAHBNSJG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |