C11H11ClFN3O4S — CID 103051710
3-amino-5-chloro-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzenesulfonamide (PubChem CID 103051710) has the molecular formula C11H11ClFN3O4S and a molecular weight of 335.74 g/mol. Its IUPAC name is 3-amino-5-chloro-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103051710 |
| Molecular Formula | C11H11ClFN3O4S |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 3-amino-5-chloro-N-(2,6-dioxopiperidin-3-yl)-2-fluorobenzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)NC2CCC(=O)NC2=O)c1F |
| InChI | InChI=1S/C11H11ClFN3O4S/c12-5-3-6(14)10(13)8(4-5)21(19,20)16-7-1-2-9(17)15-11(7)18/h3-4,7,16H,1-2,14H2,(H,15,17,18) |
| InChIKey | HYAYXDDRDVEZDM-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|