C11H11ClFN3O2S — CID 103051987
1-[(5-chloro-2-fluorophenyl)methyl]-2-methylimidazole-4-sulfonamide (PubChem CID 103051987) has the molecular formula C11H11ClFN3O2S and a molecular weight of 303.75 g/mol. Its IUPAC name is 1-[(5-chloro-2-fluorophenyl)methyl]-2-methylimidazole-4-sulfonamide.
| Compound Name | 1-[(5-chloro-2-fluorophenyl)methyl]-2-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 103051987 |
| Molecular Formula | C11H11ClFN3O2S |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 1-[(5-chloro-2-fluorophenyl)methyl]-2-methylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(N)(=O)=O)cn1Cc1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H11ClFN3O2S/c1-7-15-11(19(14,17)18)6-16(7)5-8-4-9(12)2-3-10(8)13/h2-4,6H,5H2,1H3,(H2,14,17,18) |
| InChIKey | KEQMSVNTRSQXNM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |