C15H15ClF2N2 — CID 103053108
2-(5-chloro-2-fluorophenyl)-N-ethyl-1-(5-fluoro-3-pyridinyl)ethanamine (PubChem CID 103053108) has the molecular formula C15H15ClF2N2 and a molecular weight of 296.75 g/mol. Its IUPAC name is 2-(5-chloro-2-fluorophenyl)-N-ethyl-1-(5-fluoro-3-pyridinyl)ethanamine.
| Compound Name | 2-(5-chloro-2-fluorophenyl)-N-ethyl-1-(5-fluoro-3-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 103053108 |
| Molecular Formula | C15H15ClF2N2 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-(5-chloro-2-fluorophenyl)-N-ethyl-1-(5-fluoro-3-pyridinyl)ethanamine |
| SMILES | CCNC(Cc1cc(Cl)ccc1F)c1cncc(F)c1 |
| InChI | InChI=1S/C15H15ClF2N2/c1-2-20-15(11-6-13(17)9-19-8-11)7-10-5-12(16)3-4-14(10)18/h3-6,8-9,15,20H,2,7H2,1H3 |
| InChIKey | LKCQCZWMSAWFOL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |