C13H20ClFN2O — CID 103053888
[1-(5-chloro-2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]hydrazine (PubChem CID 103053888) has the molecular formula C13H20ClFN2O and a molecular weight of 274.77 g/mol. Its IUPAC name is [1-(5-chloro-2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]hydrazine.
| Compound Name | [1-(5-chloro-2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103053888 |
| Molecular Formula | C13H20ClFN2O |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [1-(5-chloro-2-fluorophenyl)-3-[(2-methylpropan-2-yl)oxy]propan-2-yl]hydrazine |
| SMILES | CC(C)(C)OCC(Cc1cc(Cl)ccc1F)NN |
| InChI | InChI=1S/C13H20ClFN2O/c1-13(2,3)18-8-11(17-16)7-9-6-10(14)4-5-12(9)15/h4-6,11,17H,7-8,16H2,1-3H3 |
| InChIKey | JTLBZYPZWGFGIS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|