C13H7Cl2N3O2 — CID 103054531
7-chloro-1-[(5-chloropyrazin-2-yl)methyl]indole-2,3-dione (PubChem CID 103054531) has the molecular formula C13H7Cl2N3O2 and a molecular weight of 308.12 g/mol. Its IUPAC name is 7-chloro-1-[(5-chloropyrazin-2-yl)methyl]indole-2,3-dione.
| Compound Name | 7-chloro-1-[(5-chloropyrazin-2-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 103054531 |
| Molecular Formula | C13H7Cl2N3O2 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 7-chloro-1-[(5-chloropyrazin-2-yl)methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cnc(Cl)cn2)c2c(Cl)cccc21 |
| InChI | InChI=1S/C13H7Cl2N3O2/c14-9-3-1-2-8-11(9)18(13(20)12(8)19)6-7-4-17-10(15)5-16-7/h1-5H,6H2 |
| InChIKey | GIIFSRVOAMGQIZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|