C12H15ClN4O2 — CID 103054614
1-[(5-chloropyrazin-2-yl)methyl]-4-propylpiperazine-2,5-dione (PubChem CID 103054614) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is 1-[(5-chloropyrazin-2-yl)methyl]-4-propylpiperazine-2,5-dione.
| Compound Name | 1-[(5-chloropyrazin-2-yl)methyl]-4-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 103054614 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 1-[(5-chloropyrazin-2-yl)methyl]-4-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(Cc2cnc(Cl)cn2)CC1=O |
| InChI | InChI=1S/C12H15ClN4O2/c1-2-3-16-7-12(19)17(8-11(16)18)6-9-4-15-10(13)5-14-9/h4-5H,2-3,6-8H2,1H3 |
| InChIKey | FKUDHALTQHIOKR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |