C16H23N5 — CID 103055881
5-[[ethyl(pyridin-4-ylmethyl)amino]methyl]-N-propylpyrazin-2-amine (PubChem CID 103055881) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 5-[[ethyl(pyridin-4-ylmethyl)amino]methyl]-N-propylpyrazin-2-amine.
| Compound Name | 5-[[ethyl(pyridin-4-ylmethyl)amino]methyl]-N-propylpyrazin-2-amine |
|---|---|
| PubChem CID | 103055881 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 5-[[ethyl(pyridin-4-ylmethyl)amino]methyl]-N-propylpyrazin-2-amine |
| SMILES | CCCNc1cnc(CN(CC)Cc2ccncc2)cn1 |
| InChI | InChI=1S/C16H23N5/c1-3-7-18-16-11-19-15(10-20-16)13-21(4-2)12-14-5-8-17-9-6-14/h5-6,8-11H,3-4,7,12-13H2,1-2H3,(H,18,20) |
| InChIKey | DXCVXGIPZNMVAT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |