C10H16N4O — CID 103056325
5-(1,4-oxazepan-4-ylmethyl)pyrazin-2-amine (PubChem CID 103056325) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 5-(1,4-oxazepan-4-ylmethyl)pyrazin-2-amine.
| Compound Name | 5-(1,4-oxazepan-4-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 103056325 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5-(1,4-oxazepan-4-ylmethyl)pyrazin-2-amine |
| SMILES | Nc1cnc(CN2CCCOCC2)cn1 |
| InChI | InChI=1S/C10H16N4O/c11-10-7-12-9(6-13-10)8-14-2-1-4-15-5-3-14/h6-7H,1-5,8H2,(H2,11,13) |
| InChIKey | NJZPBAKHQWDAIQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |