C16H26N4O — CID 103056725
2-[[5-(ethylamino)pyrazin-2-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 103056725) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[[5-(ethylamino)pyrazin-2-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[[5-(ethylamino)pyrazin-2-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 103056725 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 2-[[5-(ethylamino)pyrazin-2-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CCNc1cnc(CN2CCC3(O)CCCCC3C2)cn1 |
| InChI | InChI=1S/C16H26N4O/c1-2-17-15-10-18-14(9-19-15)12-20-8-7-16(21)6-4-3-5-13(16)11-20/h9-10,13,21H,2-8,11-12H2,1H3,(H,17,19) |
| InChIKey | IXVJGXOATFTCMT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |