About N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine
N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine (PubChem CID 103056905) has the molecular formula C15H27N5
and a molecular weight of 277.42 g/mol. Its IUPAC name is N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine |
| PubChem CID | 103056905 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine |
| SMILES | CCCNc1cnc(CN2CC(C)N(C)C(C)C2)cn1 |
| InChI | InChI=1S/C15H27N5/c1-5-6-16-15-8-17-14(7-18-15)11-20-9-12(2)19(4)13(3)10-20/h7-8,12-13H,5-6,9-11H2,1-4H3,(H,16,18) |
| InChIKey | OSKCQGBASCQJRT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine?
The IUPAC name of N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine (CID 103056905) is N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine.
What is the SMILES notation for N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine?
The canonical SMILES for N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine is CCCNc1cnc(CN2CC(C)N(C)C(C)C2)cn1.
What is the InChIKey of N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine?
The InChIKey is OSKCQGBASCQJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N5/c1-5-6-16-15-8-17-14(7-18-15)11-20-9-12(2)19(4)13(3)10-20/h7-8,12-13H,5-6,9-11H2,1-4H3,(H,16,18).
What are the key properties of N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine?
N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine has a molecular weight of 277.42 g/mol, XLogP of 1.82, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-5-[(3,4,5-trimethylpiperazin-1-yl)methyl]pyrazin-2-amine is sourced from PubChem (CID 103056905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).