About 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine (PubChem CID 103057201) has the molecular formula C13H18ClN5
and a molecular weight of 279.77 g/mol. Its IUPAC name is 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine.
Molecular Properties
| Compound Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine |
| PubChem CID | 103057201 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine |
| SMILES | CCCNc1cnc(Cn2nc(C)c(Cl)c2C)cn1 |
| InChI | InChI=1S/C13H18ClN5/c1-4-5-15-12-7-16-11(6-17-12)8-19-10(3)13(14)9(2)18-19/h6-7H,4-5,8H2,1-3H3,(H,15,17) |
| InChIKey | YJBGFNTWESTCSM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine?
The IUPAC name of 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine (CID 103057201) is 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine.
What is the SMILES notation for 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine?
The canonical SMILES for 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine is CCCNc1cnc(Cn2nc(C)c(Cl)c2C)cn1.
What is the InChIKey of 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine?
The InChIKey is YJBGFNTWESTCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClN5/c1-4-5-15-12-7-16-11(6-17-12)8-19-10(3)13(14)9(2)18-19/h6-7H,4-5,8H2,1-3H3,(H,15,17).
What are the key properties of 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine?
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine has a molecular weight of 279.77 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]-N-propylpyrazin-2-amine is sourced from PubChem (CID 103057201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).