C11H12IN5O — CID 103057459
3-[[5-(ethylamino)pyrazin-2-yl]methyl]-5-iodopyrimidin-4-one (PubChem CID 103057459) has the molecular formula C11H12IN5O and a molecular weight of 357.16 g/mol. Its IUPAC name is 3-[[5-(ethylamino)pyrazin-2-yl]methyl]-5-iodopyrimidin-4-one.
| Compound Name | 3-[[5-(ethylamino)pyrazin-2-yl]methyl]-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 103057459 |
| Molecular Formula | C11H12IN5O |
| Molecular Weight | 357.16 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 3-[[5-(ethylamino)pyrazin-2-yl]methyl]-5-iodopyrimidin-4-one |
| SMILES | CCNc1cnc(Cn2cncc(I)c2=O)cn1 |
| InChI | InChI=1S/C11H12IN5O/c1-2-14-10-5-15-8(3-16-10)6-17-7-13-4-9(12)11(17)18/h3-5,7H,2,6H2,1H3,(H,14,16) |
| InChIKey | WSWXZZSTMWZRSK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.16 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|