C11H19NO4S — CID 103057738
3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]oxan-4-one (PubChem CID 103057738) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]oxan-4-one.
| Compound Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]oxan-4-one |
|---|---|
| PubChem CID | 103057738 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]oxan-4-one |
| SMILES | CN(CC1COCCC1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H19NO4S/c1-12(10-3-5-17(14,15)8-10)6-9-7-16-4-2-11(9)13/h9-10H,2-8H2,1H3 |
| InChIKey | FQCBVQVXVQUSHT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |