C14H15Cl2N3O — CID 103058081
5-[(2,5-dichlorophenoxy)methyl]-N-propylpyrazin-2-amine (PubChem CID 103058081) has the molecular formula C14H15Cl2N3O and a molecular weight of 312.20 g/mol. Its IUPAC name is 5-[(2,5-dichlorophenoxy)methyl]-N-propylpyrazin-2-amine.
| Compound Name | 5-[(2,5-dichlorophenoxy)methyl]-N-propylpyrazin-2-amine |
|---|---|
| PubChem CID | 103058081 |
| Molecular Formula | C14H15Cl2N3O |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 5-[(2,5-dichlorophenoxy)methyl]-N-propylpyrazin-2-amine |
| SMILES | CCCNc1cnc(COc2cc(Cl)ccc2Cl)cn1 |
| InChI | InChI=1S/C14H15Cl2N3O/c1-2-5-17-14-8-18-11(7-19-14)9-20-13-6-10(15)3-4-12(13)16/h3-4,6-8H,2,5,9H2,1H3,(H,17,19) |
| InChIKey | KFKAVPWJFUUKSZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |