C15H26N2O2 — CID 103058119
3-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]oxan-4-one (PubChem CID 103058119) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is 3-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]oxan-4-one.
| Compound Name | 3-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]oxan-4-one |
|---|---|
| PubChem CID | 103058119 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 3-[(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methyl]oxan-4-one |
| SMILES | CN1CCCC2CN(CC3COCCC3=O)CCC21 |
| InChI | InChI=1S/C15H26N2O2/c1-16-6-2-3-12-9-17(7-4-14(12)16)10-13-11-19-8-5-15(13)18/h12-14H,2-11H2,1H3 |
| InChIKey | WLMXZCLNZMAKCG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |