About 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one
3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one (PubChem CID 103058175) has the molecular formula C9H15F2NO2
and a molecular weight of 207.22 g/mol. Its IUPAC name is 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one.
Molecular Properties
| Compound Name | 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one |
| PubChem CID | 103058175 |
| Molecular Formula | C9H15F2NO2 |
| Molecular Weight | 207.22 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one |
| SMILES | CN(CC(F)F)CC1COCCC1=O |
| InChI | InChI=1S/C9H15F2NO2/c1-12(5-9(10)11)4-7-6-14-3-2-8(7)13/h7,9H,2-6H2,1H3 |
| InChIKey | JXTJHJRCKTUANO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one?
The IUPAC name of 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one (CID 103058175) is 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one.
What is the SMILES notation for 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one?
The canonical SMILES for 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one is CN(CC(F)F)CC1COCCC1=O.
What is the InChIKey of 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one?
The InChIKey is JXTJHJRCKTUANO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2/c1-12(5-9(10)11)4-7-6-14-3-2-8(7)13/h7,9H,2-6H2,1H3.
What are the key properties of 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one?
3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one has a molecular weight of 207.22 g/mol, XLogP of 0.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,2-difluoroethyl(methyl)amino]methyl]oxan-4-one is sourced from PubChem (CID 103058175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).