C38H41N9O8 — CID 10305890
4-[[2-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carbonyl]amino]ethylcarbamoylamino]methyl]benzoic acid (PubChem CID 10305890) has the molecular formula C38H41N9O8 and a molecular weight of 751.80 g/mol. Its IUPAC name is 4-[[2-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carbonyl]amino]ethylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carbonyl]amino]ethylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 10305890 |
| Molecular Formula | C38H41N9O8 |
| Molecular Weight | 751.80 g/mol |
| Exact Mass | 751.31 |
| IUPAC Name | 4-[[2-[[6-(2,2-diphenylethylamino)-9-[(2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxyoxolan-2-yl]purine-2-carbonyl]amino]ethylcarbamoylamino]methyl]benzoic acid |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(C(=O)NCCNC(=O)NCc4ccc(C(=O)O)cc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C38H41N9O8/c1-2-39-34(50)30-28(48)29(49)36(55-30)47-21-44-27-31(42-20-26(23-9-5-3-6-10-23)24-11-7-4-8-12-24)45-32(46-33(27)47)35(51)40-17-18-41-38(54)43-19-22-13-15-25(16-14-22)37(52)53/h3-16,21,26,28-30,36,48-49H,2,17-20H2,1H3,(H,39,50)(H,40,51)(H,52,53)(H2,41,43,54)(H,42,45,46)/t28-,29+,30-,36+/m0/s1 |
| InChIKey | SLASUOSJPVRJDB-BBJOTMRQSA-N |
| XLogP | 1.75 |
| TPSA | 241.95 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.80 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|