C13H16N4S — CID 103059738
N-propyl-5-(pyridin-2-ylsulfanylmethyl)pyrazin-2-amine (PubChem CID 103059738) has the molecular formula C13H16N4S and a molecular weight of 260.37 g/mol. Its IUPAC name is N-propyl-5-(pyridin-2-ylsulfanylmethyl)pyrazin-2-amine.
| Compound Name | N-propyl-5-(pyridin-2-ylsulfanylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 103059738 |
| Molecular Formula | C13H16N4S |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-propyl-5-(pyridin-2-ylsulfanylmethyl)pyrazin-2-amine |
| SMILES | CCCNc1cnc(CSc2ccccn2)cn1 |
| InChI | InChI=1S/C13H16N4S/c1-2-6-14-12-9-16-11(8-17-12)10-18-13-5-3-4-7-15-13/h3-5,7-9H,2,6,10H2,1H3,(H,14,17) |
| InChIKey | MAOQOPUFWZCKTM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |