About 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine
5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine (PubChem CID 103060352) has the molecular formula C11H15N5S3
and a molecular weight of 313.48 g/mol. Its IUPAC name is 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine.
Molecular Properties
| Compound Name | 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine |
| PubChem CID | 103060352 |
| Molecular Formula | C11H15N5S3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine |
| SMILES | CCCNc1cnc(CSc2nnc(SC)s2)cn1 |
| InChI | InChI=1S/C11H15N5S3/c1-3-4-12-9-6-13-8(5-14-9)7-18-11-16-15-10(17-2)19-11/h5-6H,3-4,7H2,1-2H3,(H,12,14) |
| InChIKey | DLLJTTDSEGDOJM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine?
The IUPAC name of 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine (CID 103060352) is 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine.
What is the SMILES notation for 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine?
The canonical SMILES for 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine is CCCNc1cnc(CSc2nnc(SC)s2)cn1.
What is the InChIKey of 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine?
The InChIKey is DLLJTTDSEGDOJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5S3/c1-3-4-12-9-6-13-8(5-14-9)7-18-11-16-15-10(17-2)19-11/h5-6H,3-4,7H2,1-2H3,(H,12,14).
What are the key properties of 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine?
5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine has a molecular weight of 313.48 g/mol, XLogP of 3.16, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-N-propylpyrazin-2-amine is sourced from PubChem (CID 103060352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).