C12H18BrNO2S — CID 103061385
3-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]oxan-4-ol (PubChem CID 103061385) has the molecular formula C12H18BrNO2S and a molecular weight of 320.25 g/mol. Its IUPAC name is 3-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]oxan-4-ol.
| Compound Name | 3-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 103061385 |
| Molecular Formula | C12H18BrNO2S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 3-[[(4-bromothiophen-2-yl)methyl-methylamino]methyl]oxan-4-ol |
| SMILES | CN(Cc1cc(Br)cs1)CC1COCCC1O |
| InChI | InChI=1S/C12H18BrNO2S/c1-14(6-11-4-10(13)8-17-11)5-9-7-16-3-2-12(9)15/h4,8-9,12,15H,2-3,5-7H2,1H3 |
| InChIKey | GOKQJCXZXJROSK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |