C12H17N7O — CID 103061659
5-[ethyl(methyl)amino]-2-[(5-hydrazinylpyrazin-2-yl)methyl]pyridazin-3-one (PubChem CID 103061659) has the molecular formula C12H17N7O and a molecular weight of 275.32 g/mol. Its IUPAC name is 5-[ethyl(methyl)amino]-2-[(5-hydrazinylpyrazin-2-yl)methyl]pyridazin-3-one.
| Compound Name | 5-[ethyl(methyl)amino]-2-[(5-hydrazinylpyrazin-2-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103061659 |
| Molecular Formula | C12H17N7O |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 5-[ethyl(methyl)amino]-2-[(5-hydrazinylpyrazin-2-yl)methyl]pyridazin-3-one |
| SMILES | CCN(C)c1cnn(Cc2cnc(NN)cn2)c(=O)c1 |
| InChI | InChI=1S/C12H17N7O/c1-3-18(2)10-4-12(20)19(16-6-10)8-9-5-15-11(17-13)7-14-9/h4-7H,3,8,13H2,1-2H3,(H,15,17) |
| InChIKey | LSTUEGBTXKTGOF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|