C11H18N4O2S — CID 103062127
tert-butyl 2-[(5-hydrazinylpyrazin-2-yl)methylsulfanyl]acetate (PubChem CID 103062127) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is tert-butyl 2-[(5-hydrazinylpyrazin-2-yl)methylsulfanyl]acetate.
| Compound Name | tert-butyl 2-[(5-hydrazinylpyrazin-2-yl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 103062127 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | tert-butyl 2-[(5-hydrazinylpyrazin-2-yl)methylsulfanyl]acetate |
| SMILES | CC(C)(C)OC(=O)CSCc1cnc(NN)cn1 |
| InChI | InChI=1S/C11H18N4O2S/c1-11(2,3)17-10(16)7-18-6-8-4-14-9(15-12)5-13-8/h4-5H,6-7,12H2,1-3H3,(H,14,15) |
| InChIKey | SVCCVOKNAJKPLB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|